C6H10ClF3N2O3P- — CID 148550048
chloro-[methyl-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethyl]amino]phosphinate (PubChem CID 148550048) has the molecular formula C6H10ClF3N2O3P- and a molecular weight of 281.58 g/mol. Its IUPAC name is chloro-[methyl-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethyl]amino]phosphinate.
| Compound Name | chloro-[methyl-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethyl]amino]phosphinate |
|---|---|
| PubChem CID | 148550048 |
| Molecular Formula | C6H10ClF3N2O3P- |
| Molecular Weight | 281.58 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | chloro-[methyl-[2-[methyl-(2,2,2-trifluoroacetyl)amino]ethyl]amino]phosphinate |
| SMILES | CN(CCN(C)P(=O)([O-])Cl)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6H11ClF3N2O3P/c1-11(5(13)6(8,9)10)3-4-12(2)16(7,14)15/h3-4H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | OBKQYXXSDCKYRR-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.58 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|