C11H12F3NO3S — CID 148550078
2-[3-(trifluoromethyl)phenyl]sulfonylbutanamide (PubChem CID 148550078) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]sulfonylbutanamide.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]sulfonylbutanamide |
|---|---|
| PubChem CID | 148550078 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]sulfonylbutanamide |
| SMILES | CCC(C(N)=O)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3NO3S/c1-2-9(10(15)16)19(17,18)8-5-3-4-7(6-8)11(12,13)14/h3-6,9H,2H2,1H3,(H2,15,16) |
| InChIKey | HMBRMXGYJCGHLR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |