C17H22BNO2 — CID 148551117
8-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (PubChem CID 148551117) has the molecular formula C17H22BNO2 and a molecular weight of 283.18 g/mol. Its IUPAC name is 8-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline.
| Compound Name | 8-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 148551117 |
| Molecular Formula | C17H22BNO2 |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 8-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| SMILES | CCc1cc(B2OC(C)(C)C(C)(C)O2)cc2cccnc12 |
| InChI | InChI=1S/C17H22BNO2/c1-6-12-10-14(11-13-8-7-9-19-15(12)13)18-20-16(2,3)17(4,5)21-18/h7-11H,6H2,1-5H3 |
| InChIKey | MTEAWRQQRWBTQU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|