C30H46O3P+ — CID 148551323
7-[4-[2-(3,5-dihydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methyl-2-(2H-phosphiren-1-ium-1-yl)octan-3-one (PubChem CID 148551323) has the molecular formula C30H46O3P+ and a molecular weight of 485.67 g/mol. Its IUPAC name is 7-[4-[2-(3,5-dihydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methyl-2-(2H-phosphiren-1-ium-1-yl)octan-3-one.
| Compound Name | 7-[4-[2-(3,5-dihydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methyl-2-(2H-phosphiren-1-ium-1-yl)octan-3-one |
|---|---|
| PubChem CID | 148551323 |
| Molecular Formula | C30H46O3P+ |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | 7-[4-[2-(3,5-dihydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methyl-2-(2H-phosphiren-1-ium-1-yl)octan-3-one |
| SMILES | C=C1C(=CC=C2CCCC3(C)C2CCC3C(C)CCCC(=O)C(C)(C)[P+]2=CC2)CC(O)CC1O |
| InChI | InChI=1S/C30H46O3P/c1-20(8-6-10-28(33)29(3,4)34-16-17-34)25-13-14-26-22(9-7-15-30(25,26)5)11-12-23-18-24(31)19-27(32)21(23)2/h11-12,16,20,24-27,31-32H,2,6-10,13-15,17-19H2,1,3-5H3/q+1 |
| InChIKey | GTTMEWRERYSXAN-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|