About 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile
7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile (PubChem CID 1485518) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile.
Analyze 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile?
The IUPAC name of 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile (CID 1485518) is 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile.
What is the SMILES notation for 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile?
The canonical SMILES for 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile is N#Cc1cnn2c(C3CC3)ccnc12.
What is the InChIKey of 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile?
The InChIKey is CNTLWKOXJAQYQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4/c11-5-8-6-13-14-9(7-1-2-7)3-4-12-10(8)14/h3-4,6-7H,1-2H2.
What are the key properties of 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile?
7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile has a molecular weight of 184.20 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopropylpyrazolo[1,5-a]pyrimidine-3-carbonitrile is sourced from PubChem (CID 1485518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).