C27H24F2N4O2 — CID 148556826
[(1R,8S)-5-(3,5-difluoro-4-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone (PubChem CID 148556826) has the molecular formula C27H24F2N4O2 and a molecular weight of 474.51 g/mol. Its IUPAC name is [(1R,8S)-5-(3,5-difluoro-4-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone.
| Compound Name | [(1R,8S)-5-(3,5-difluoro-4-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 148556826 |
| Molecular Formula | C27H24F2N4O2 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | [(1R,8S)-5-(3,5-difluoro-4-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone |
| SMILES | COc1c(F)cc(-c2c3c(nn2C)[C@H]2CCC[C@@H](C3)N2C(=O)c2ccc3ncccc3c2)cc1F |
| InChI | InChI=1S/C27H24F2N4O2/c1-32-25(17-12-20(28)26(35-2)21(29)13-17)19-14-18-6-3-7-23(24(19)31-32)33(18)27(34)16-8-9-22-15(11-16)5-4-10-30-22/h4-5,8-13,18,23H,3,6-7,14H2,1-2H3/t18-,23+/m0/s1 |
| InChIKey | MUFMVISNFPFYQZ-FDDCHVKYSA-N |
| XLogP | 5.21 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |