About (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide
(methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide (PubChem CID 148558031) has the molecular formula C3H8NO3S2-
and a molecular weight of 170.23 g/mol. Its IUPAC name is (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide.
Molecular Properties
| Compound Name | (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide |
| PubChem CID | 148558031 |
| Molecular Formula | C3H8NO3S2- |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide |
| SMILES | C=S(C)(=O)[N-]S(C)(=O)=O |
| InChI | InChI=1S/C3H8NO3S2/c1-8(2,5)4-9(3,6)7/h1H2,2-3H3/q-1 |
| InChIKey | MULHWRVCNIRGLO-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide?
The IUPAC name of (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide (CID 148558031) is (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide.
What is the SMILES notation for (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide?
The canonical SMILES for (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide is C=S(C)(=O)[N-]S(C)(=O)=O.
What is the InChIKey of (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide?
The InChIKey is MULHWRVCNIRGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8NO3S2/c1-8(2,5)4-9(3,6)7/h1H2,2-3H3/q-1.
What are the key properties of (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide?
(methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide has a molecular weight of 170.23 g/mol, XLogP of -0.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (methyl-methylidene-oxo-λ6-sulfanyl)-methylsulfonylazanide is sourced from PubChem (CID 148558031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).