C17H14ClF3N2O5S — CID 148558205
[4-[2-(5-chloro-2-pyridinyl)acetyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridin-2-yl] trifluoromethanesulfonate (PubChem CID 148558205) has the molecular formula C17H14ClF3N2O5S and a molecular weight of 450.82 g/mol. Its IUPAC name is [4-[2-(5-chloro-2-pyridinyl)acetyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridin-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-[2-(5-chloro-2-pyridinyl)acetyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 148558205 |
| Molecular Formula | C17H14ClF3N2O5S |
| Molecular Weight | 450.82 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | [4-[2-(5-chloro-2-pyridinyl)acetyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridin-2-yl] trifluoromethanesulfonate |
| SMILES | O=C(Cc1ccc(Cl)cn1)c1cc(OS(=O)(=O)C(F)(F)F)nc2c1CCOCC2 |
| InChI | InChI=1S/C17H14ClF3N2O5S/c18-10-1-2-11(22-9-10)7-15(24)13-8-16(28-29(25,26)17(19,20)21)23-14-4-6-27-5-3-12(13)14/h1-2,8-9H,3-7H2 |
| InChIKey | MUMDPGBAUUVYEK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.82 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|