C18H19NO3 — CID 148559549
5-(3-cyanophenyl)-2,2-dicyclopropyl-4-oxopentanoic acid (PubChem CID 148559549) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 5-(3-cyanophenyl)-2,2-dicyclopropyl-4-oxopentanoic acid.
| Compound Name | 5-(3-cyanophenyl)-2,2-dicyclopropyl-4-oxopentanoic acid |
|---|---|
| PubChem CID | 148559549 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 5-(3-cyanophenyl)-2,2-dicyclopropyl-4-oxopentanoic acid |
| SMILES | N#Cc1cccc(CC(=O)CC(C(=O)O)(C2CC2)C2CC2)c1 |
| InChI | InChI=1S/C18H19NO3/c19-11-13-3-1-2-12(8-13)9-16(20)10-18(17(21)22,14-4-5-14)15-6-7-15/h1-3,8,14-15H,4-7,9-10H2,(H,21,22) |
| InChIKey | MUSOVKVOPSYFIE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |