About 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride
4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride (PubChem CID 14856014) has the molecular formula C12H18ClN5O
and a molecular weight of 283.76 g/mol. Its IUPAC name is 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride.
Molecular Properties
| Compound Name | 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride |
| PubChem CID | 14856014 |
| Molecular Formula | C12H18ClN5O |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride |
| SMILES | Cc1nc(N2CCNCC2)nc2c1CC(=O)N2C.Cl |
| InChI | InChI=1S/C12H17N5O.ClH/c1-8-9-7-10(18)16(2)11(9)15-12(14-8)17-5-3-13-4-6-17;/h13H,3-7H2,1-2H3;1H |
| InChIKey | WDLHSXILRNXZAM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride?
The IUPAC name of 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride (CID 14856014) is 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride.
What is the SMILES notation for 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride?
The canonical SMILES for 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride is Cc1nc(N2CCNCC2)nc2c1CC(=O)N2C.Cl.
What is the InChIKey of 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride?
The InChIKey is WDLHSXILRNXZAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O.ClH/c1-8-9-7-10(18)16(2)11(9)15-12(14-8)17-5-3-13-4-6-17;/h13H,3-7H2,1-2H3;1H.
What are the key properties of 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride?
4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride has a molecular weight of 283.76 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-2-piperazin-1-yl-5H-pyrrolo[2,3-d]pyrimidin-6-one;hydrochloride is sourced from PubChem (CID 14856014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).