About 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one
2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 14856046) has the molecular formula C10H13N5O
and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| PubChem CID | 14856046 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | O=C1Cc2cnc(N3CCNCC3)nc2N1 |
| InChI | InChI=1S/C10H13N5O/c16-8-5-7-6-12-10(14-9(7)13-8)15-3-1-11-2-4-15/h6,11H,1-5H2,(H,12,13,14,16) |
| InChIKey | XXEWQLQWEJIYQP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The IUPAC name of 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (CID 14856046) is 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
What is the SMILES notation for 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The canonical SMILES for 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one is O=C1Cc2cnc(N3CCNCC3)nc2N1.
What is the InChIKey of 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The InChIKey is XXEWQLQWEJIYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O/c16-8-5-7-6-12-10(14-9(7)13-8)15-3-1-11-2-4-15/h6,11H,1-5H2,(H,12,13,14,16).
What are the key properties of 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one has a molecular weight of 219.25 g/mol, XLogP of -0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one is sourced from PubChem (CID 14856046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).