C22H17NO6 — CID 14856111
4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxy-N-(4-methylphenyl)benzamide (PubChem CID 14856111) has the molecular formula C22H17NO6 and a molecular weight of 391.38 g/mol. Its IUPAC name is 4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxy-N-(4-methylphenyl)benzamide.
| Compound Name | 4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxy-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 14856111 |
| Molecular Formula | C22H17NO6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxy-N-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(O)c(C(=O)c3c(O)cccc3O)c(C=O)c2)cc1 |
| InChI | InChI=1S/C22H17NO6/c1-12-5-7-15(8-6-12)23-22(29)13-9-14(11-24)19(18(27)10-13)21(28)20-16(25)3-2-4-17(20)26/h2-11,25-27H,1H3,(H,23,29) |
| InChIKey | UAIAXYKYLACCGU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|