C19H15F3N4O2 — CID 1485637
N-[(3-methoxyphenyl)methyl]-2-pyridin-2-yl-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 1485637) has the molecular formula C19H15F3N4O2 and a molecular weight of 388.35 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-2-pyridin-2-yl-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-2-pyridin-2-yl-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 1485637 |
| Molecular Formula | C19H15F3N4O2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-2-pyridin-2-yl-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2cnc(-c3ccccn3)nc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N4O2/c1-28-13-6-4-5-12(9-13)10-25-18(27)14-11-24-17(15-7-2-3-8-23-15)26-16(14)19(20,21)22/h2-9,11H,10H2,1H3,(H,25,27) |
| InChIKey | GQAIHPSZPUPSPF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |