C33H40F2N2O5 — CID 148565587
(4S,5R)-3-[[5-(butylamino)-2-[5-(3,3-dihydroxypropyl)-2-methoxyphenyl]phenyl]methyl]-5-[3-(1,1-difluoroethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 148565587) has the molecular formula C33H40F2N2O5 and a molecular weight of 582.69 g/mol. Its IUPAC name is (4S,5R)-3-[[5-(butylamino)-2-[5-(3,3-dihydroxypropyl)-2-methoxyphenyl]phenyl]methyl]-5-[3-(1,1-difluoroethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[[5-(butylamino)-2-[5-(3,3-dihydroxypropyl)-2-methoxyphenyl]phenyl]methyl]-5-[3-(1,1-difluoroethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 148565587 |
| Molecular Formula | C33H40F2N2O5 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | (4S,5R)-3-[[5-(butylamino)-2-[5-(3,3-dihydroxypropyl)-2-methoxyphenyl]phenyl]methyl]-5-[3-(1,1-difluoroethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CCCCNc1ccc(-c2cc(CCC(O)O)ccc2OC)c(CN2C(=O)O[C@H](c3cccc(C(C)(F)F)c3)[C@@H]2C)c1 |
| InChI | InChI=1S/C33H40F2N2O5/c1-5-6-16-36-26-12-13-27(28-17-22(11-15-30(38)39)10-14-29(28)41-4)24(19-26)20-37-21(2)31(42-32(37)40)23-8-7-9-25(18-23)33(3,34)35/h7-10,12-14,17-19,21,30-31,36,38-39H,5-6,11,15-16,20H2,1-4H3/t21-,31-/m0/s1 |
| InChIKey | MVVYAMORDDFZAO-BGOLNKOXSA-N |
| XLogP | 7.01 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|