C23H27NO2 — CID 148566346
[(8bS)-8b-methyl-2,3,3a,4-tetrahydro-1H-cyclopenta[b]indol-7-yl] 2-(4-propan-2-ylphenyl)acetate (PubChem CID 148566346) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is [(8bS)-8b-methyl-2,3,3a,4-tetrahydro-1H-cyclopenta[b]indol-7-yl] 2-(4-propan-2-ylphenyl)acetate.
| Compound Name | [(8bS)-8b-methyl-2,3,3a,4-tetrahydro-1H-cyclopenta[b]indol-7-yl] 2-(4-propan-2-ylphenyl)acetate |
|---|---|
| PubChem CID | 148566346 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | [(8bS)-8b-methyl-2,3,3a,4-tetrahydro-1H-cyclopenta[b]indol-7-yl] 2-(4-propan-2-ylphenyl)acetate |
| SMILES | CC(C)c1ccc(CC(=O)Oc2ccc3c(c2)[C@]2(C)CCCC2N3)cc1 |
| InChI | InChI=1S/C23H27NO2/c1-15(2)17-8-6-16(7-9-17)13-22(25)26-18-10-11-20-19(14-18)23(3)12-4-5-21(23)24-20/h6-11,14-15,21,24H,4-5,12-13H2,1-3H3/t21?,23-/m0/s1 |
| InChIKey | MVZQCDDHMQOUEL-YANBTOMASA-N |
| XLogP | 5.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|