C22H29NO2 — CID 14856758
(3S,8R,9S,10R,13S,14S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16-carbonitrile (PubChem CID 14856758) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16-carbonitrile.
| Compound Name | (3S,8R,9S,10R,13S,14S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16-carbonitrile |
|---|---|
| PubChem CID | 14856758 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16-carbonitrile |
| SMILES | CC(=O)C1=C(C#N)C[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H29NO2/c1-13(24)20-14(12-23)10-19-17-5-4-15-11-16(25)6-8-21(15,2)18(17)7-9-22(19,20)3/h4,16-19,25H,5-11H2,1-3H3/t16-,17+,18-,19-,21-,22-/m0/s1 |
| InChIKey | DULJHOBJVVEBFO-LXIBVNSESA-N |
| XLogP | 4.33 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|