C25H25ClF2N6O2 — CID 148570145
1-[2-[[5-chloro-2-[2-(difluoromethoxy)-4-piperazin-1-ylanilino]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one (PubChem CID 148570145) has the molecular formula C25H25ClF2N6O2 and a molecular weight of 514.96 g/mol. Its IUPAC name is 1-[2-[[5-chloro-2-[2-(difluoromethoxy)-4-piperazin-1-ylanilino]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[5-chloro-2-[2-(difluoromethoxy)-4-piperazin-1-ylanilino]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 148570145 |
| Molecular Formula | C25H25ClF2N6O2 |
| Molecular Weight | 514.96 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 1-[2-[[5-chloro-2-[2-(difluoromethoxy)-4-piperazin-1-ylanilino]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccccc1Nc1nc(Nc2ccc(N3CCNCC3)cc2OC(F)F)ncc1Cl |
| InChI | InChI=1S/C25H25ClF2N6O2/c1-2-18(35)13-16-5-3-4-6-20(16)31-23-19(26)15-30-25(33-23)32-21-8-7-17(14-22(21)36-24(27)28)34-11-9-29-10-12-34/h2-8,14-15,24,29H,1,9-13H2,(H2,30,31,32,33) |
| InChIKey | MWSIOTFXDLZNPI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.96 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|