About 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde
2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde (PubChem CID 14857305) has the molecular formula C18H15NO4
and a molecular weight of 309.32 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde.
Molecular Properties
| Compound Name | 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde |
| PubChem CID | 14857305 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde |
| SMILES | CC1(C)Oc2ccc(C=O)cc2C(n2ccccc2=O)=C1C=O |
| InChI | InChI=1S/C18H15NO4/c1-18(2)14(11-21)17(19-8-4-3-5-16(19)22)13-9-12(10-20)6-7-15(13)23-18/h3-11H,1-2H3 |
| InChIKey | QGZMOSLMDIDCST-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde?
The IUPAC name of 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde (CID 14857305) is 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde.
What is the SMILES notation for 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde?
The canonical SMILES for 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde is CC1(C)Oc2ccc(C=O)cc2C(n2ccccc2=O)=C1C=O.
What is the InChIKey of 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde?
The InChIKey is QGZMOSLMDIDCST-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO4/c1-18(2)14(11-21)17(19-8-4-3-5-16(19)22)13-9-12(10-20)6-7-15(13)23-18/h3-11H,1-2H3.
What are the key properties of 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde?
2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde has a molecular weight of 309.32 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-(2-oxo-1-pyridinyl)chromene-3,6-dicarbaldehyde is sourced from PubChem (CID 14857305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).