C27H33ClFN5O2S — CID 148573725
4-[[3-(tert-butylsulfonylmethyl)-4-chlorophenyl]methyl]-5-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 148573725) has the molecular formula C27H33ClFN5O2S and a molecular weight of 546.11 g/mol. Its IUPAC name is 4-[[3-(tert-butylsulfonylmethyl)-4-chlorophenyl]methyl]-5-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[[3-(tert-butylsulfonylmethyl)-4-chlorophenyl]methyl]-5-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 148573725 |
| Molecular Formula | C27H33ClFN5O2S |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 4-[[3-(tert-butylsulfonylmethyl)-4-chlorophenyl]methyl]-5-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(F)c(Cc4ccc(Cl)c(CS(=O)(=O)C(C)(C)C)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C27H33ClFN5O2S/c1-27(2,3)37(35,36)18-20-15-19(5-10-23(20)28)16-25-24(29)17-30-26(32-25)31-21-6-8-22(9-7-21)34-13-11-33(4)12-14-34/h5-10,15,17H,11-14,16,18H2,1-4H3,(H,30,31,32) |
| InChIKey | MXJMDQVEMBNZOG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|