C42H42N4O8 — CID 148573852
4-[5-[15-[3-(3-carboxypropoxy)-4-methoxyphenyl]-2,3,12,13,22,24-hexahydroporphyrin-5-yl]-2-methoxyphenoxy]butanoic acid (PubChem CID 148573852) has the molecular formula C42H42N4O8 and a molecular weight of 730.82 g/mol. Its IUPAC name is 4-[5-[15-[3-(3-carboxypropoxy)-4-methoxyphenyl]-2,3,12,13,22,24-hexahydroporphyrin-5-yl]-2-methoxyphenoxy]butanoic acid.
| Compound Name | 4-[5-[15-[3-(3-carboxypropoxy)-4-methoxyphenyl]-2,3,12,13,22,24-hexahydroporphyrin-5-yl]-2-methoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 148573852 |
| Molecular Formula | C42H42N4O8 |
| Molecular Weight | 730.82 g/mol |
| Exact Mass | 730.30 |
| IUPAC Name | 4-[5-[15-[3-(3-carboxypropoxy)-4-methoxyphenyl]-2,3,12,13,22,24-hexahydroporphyrin-5-yl]-2-methoxyphenoxy]butanoic acid |
| SMILES | COc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccc(OC)c(OCCCC(=O)O)c4)c4nc(cc5ccc2[nH]5)CC4)CC3)cc1OCCCC(=O)O |
| InChI | InChI=1S/C42H42N4O8/c1-51-35-17-7-25(21-37(35)53-19-3-5-39(47)48)41-31-13-9-27(43-31)23-29-11-15-33(45-29)42(34-16-12-30(46-34)24-28-10-14-32(41)44-28)26-8-18-36(52-2)38(22-26)54-20-4-6-40(49)50/h7-9,12-13,16-18,21-24,43,46H,3-6,10-11,14-15,19-20H2,1-2H3,(H,47,48)(H,49,50)/b27-23-,28-24-,29-23-,30-24-,41-31-,41-32-,42-33-,42-34- |
| InChIKey | MXKAFBKKPNWYGE-BJJSMMANSA-N |
| XLogP | 7.72 |
| TPSA | 168.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.82 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|