C13H13F3O2S — CID 14857437
2,2-dimethyl-6-(2,2,2-trifluoroethylsulfinyl)chromene (PubChem CID 14857437) has the molecular formula C13H13F3O2S and a molecular weight of 290.31 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2,2,2-trifluoroethylsulfinyl)chromene.
| Compound Name | 2,2-dimethyl-6-(2,2,2-trifluoroethylsulfinyl)chromene |
|---|---|
| PubChem CID | 14857437 |
| Molecular Formula | C13H13F3O2S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2,2-dimethyl-6-(2,2,2-trifluoroethylsulfinyl)chromene |
| SMILES | CC1(C)C=Cc2cc(S(=O)CC(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C13H13F3O2S/c1-12(2)6-5-9-7-10(3-4-11(9)18-12)19(17)8-13(14,15)16/h3-7H,8H2,1-2H3 |
| InChIKey | TXPZDKPBDVFXPX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |