C25H31NO2S2 — CID 148574475
O-phenyl 3-[1,3,3-trimethyl-5-(phenoxycarbothioylamino)cyclohexyl]propanethioate (PubChem CID 148574475) has the molecular formula C25H31NO2S2 and a molecular weight of 441.66 g/mol. Its IUPAC name is O-phenyl 3-[1,3,3-trimethyl-5-(phenoxycarbothioylamino)cyclohexyl]propanethioate.
| Compound Name | O-phenyl 3-[1,3,3-trimethyl-5-(phenoxycarbothioylamino)cyclohexyl]propanethioate |
|---|---|
| PubChem CID | 148574475 |
| Molecular Formula | C25H31NO2S2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | O-phenyl 3-[1,3,3-trimethyl-5-(phenoxycarbothioylamino)cyclohexyl]propanethioate |
| SMILES | CC1(C)CC(NC(=S)Oc2ccccc2)CC(C)(CCC(=S)Oc2ccccc2)C1 |
| InChI | InChI=1S/C25H31NO2S2/c1-24(2)16-19(26-23(30)28-21-12-8-5-9-13-21)17-25(3,18-24)15-14-22(29)27-20-10-6-4-7-11-20/h4-13,19H,14-18H2,1-3H3,(H,26,30) |
| InChIKey | MXNFVINIASUQDW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|