C28H30N4O3S — CID 14857564
4-ethyl-13-methyl-7-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 14857564) has the molecular formula C28H30N4O3S and a molecular weight of 502.64 g/mol. Its IUPAC name is 4-ethyl-13-methyl-7-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 4-ethyl-13-methyl-7-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 14857564 |
| Molecular Formula | C28H30N4O3S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 4-ethyl-13-methyl-7-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | CCc1cc2c(s1)-n1c(C)nnc1CN=C2c1ccc(CCc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H30N4O3S/c1-6-21-15-22-26(29-16-25-31-30-17(2)32(25)28(22)36-21)20-11-9-18(10-12-20)7-8-19-13-23(33-3)27(35-5)24(14-19)34-4/h9-15H,6-8,16H2,1-5H3 |
| InChIKey | LXOANMQLRHMZSW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |