About 5-chloro-2,3-dihydro-1H-indene-1-carboxamide
5-chloro-2,3-dihydro-1H-indene-1-carboxamide (PubChem CID 14857796) has the molecular formula C10H10ClNO
and a molecular weight of 195.65 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1H-indene-1-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-2,3-dihydro-1H-indene-1-carboxamide |
| PubChem CID | 14857796 |
| Molecular Formula | C10H10ClNO |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 5-chloro-2,3-dihydro-1H-indene-1-carboxamide |
| SMILES | NC(=O)C1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H10ClNO/c11-7-2-4-8-6(5-7)1-3-9(8)10(12)13/h2,4-5,9H,1,3H2,(H2,12,13) |
| InChIKey | KLCWIGJPJBEFPY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-2,3-dihydro-1H-indene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,3-dihydro-1H-indene-1-carboxamide?
The IUPAC name of 5-chloro-2,3-dihydro-1H-indene-1-carboxamide (CID 14857796) is 5-chloro-2,3-dihydro-1H-indene-1-carboxamide.
What is the SMILES notation for 5-chloro-2,3-dihydro-1H-indene-1-carboxamide?
The canonical SMILES for 5-chloro-2,3-dihydro-1H-indene-1-carboxamide is NC(=O)C1CCc2cc(Cl)ccc21.
What is the InChIKey of 5-chloro-2,3-dihydro-1H-indene-1-carboxamide?
The InChIKey is KLCWIGJPJBEFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO/c11-7-2-4-8-6(5-7)1-3-9(8)10(12)13/h2,4-5,9H,1,3H2,(H2,12,13).
What are the key properties of 5-chloro-2,3-dihydro-1H-indene-1-carboxamide?
5-chloro-2,3-dihydro-1H-indene-1-carboxamide has a molecular weight of 195.65 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3-dihydro-1H-indene-1-carboxamide is sourced from PubChem (CID 14857796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).