C6H5N3OS2 — CID 1485814
7-methyl-2-sulfanylidene-3H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 1485814) has the molecular formula C6H5N3OS2 and a molecular weight of 199.26 g/mol. Its IUPAC name is 7-methyl-2-sulfanylidene-3H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-methyl-2-sulfanylidene-3H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 1485814 |
| Molecular Formula | C6H5N3OS2 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | 7-methyl-2-sulfanylidene-3H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1cc(=O)n2[nH]c(=S)sc2n1 |
| InChI | InChI=1S/C6H5N3OS2/c1-3-2-4(10)9-5(7-3)12-6(11)8-9/h2H,1H3,(H,8,11) |
| InChIKey | IRUKGGHQKGTAPN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|