C18H21N5O4S — CID 148581689
2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-5-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide (PubChem CID 148581689) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-5-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide.
| Compound Name | 2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-5-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 148581689 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-5-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide |
| SMILES | Cc1cnc(N2CCC3OCCC32)c(C(=O)Nc2ccnc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C18H21N5O4S/c1-11-8-13(17(21-10-11)23-6-3-15-14(23)4-7-27-15)18(24)22-12-2-5-20-16(9-12)28(19,25)26/h2,5,8-10,14-15H,3-4,6-7H2,1H3,(H2,19,25,26)(H,20,22,24) |
| InChIKey | MYWBJPDZGODBKA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |