C14H17NO3 — CID 148582812
(Z)-[(4aR,10aR)-9-methoxy-3,4,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-2-ylidene]methanol (PubChem CID 148582812) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (Z)-[(4aR,10aR)-9-methoxy-3,4,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-2-ylidene]methanol.
| Compound Name | (Z)-[(4aR,10aR)-9-methoxy-3,4,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-2-ylidene]methanol |
|---|---|
| PubChem CID | 148582812 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (Z)-[(4aR,10aR)-9-methoxy-3,4,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-2-ylidene]methanol |
| SMILES | COc1cccc2c1C[C@H]1O/C(=C\O)CN[C@@H]1C2 |
| InChI | InChI=1S/C14H17NO3/c1-17-13-4-2-3-9-5-12-14(6-11(9)13)18-10(8-16)7-15-12/h2-4,8,12,14-16H,5-7H2,1H3/b10-8-/t12-,14-/m1/s1 |
| InChIKey | MZBOEGFMTDWCDY-CXJYXFFVSA-N |
| XLogP | 1.55 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|