About 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one
2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one (PubChem CID 14858469) has the molecular formula C14H9F3N2O
and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one.
Molecular Properties
| Compound Name | 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one |
| PubChem CID | 14858469 |
| Molecular Formula | C14H9F3N2O |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one |
| SMILES | Cc1ccc2nc3ccc(C(F)(F)F)cn3c(=O)c2c1 |
| InChI | InChI=1S/C14H9F3N2O/c1-8-2-4-11-10(6-8)13(20)19-7-9(14(15,16)17)3-5-12(19)18-11/h2-7H,1H3 |
| InChIKey | VAUCZXOYBNKTMT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one?
The IUPAC name of 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one (CID 14858469) is 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one.
What is the SMILES notation for 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one?
The canonical SMILES for 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one is Cc1ccc2nc3ccc(C(F)(F)F)cn3c(=O)c2c1.
What is the InChIKey of 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one?
The InChIKey is VAUCZXOYBNKTMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3N2O/c1-8-2-4-11-10(6-8)13(20)19-7-9(14(15,16)17)3-5-12(19)18-11/h2-7H,1H3.
What are the key properties of 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one?
2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one has a molecular weight of 278.23 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-8-(trifluoromethyl)pyrido[2,1-b]quinazolin-11-one is sourced from PubChem (CID 14858469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).