C9H12F2N2 — CID 148589459
2,5-difluoro-2,7,7-trimethyl-1,4-diazocine (PubChem CID 148589459) has the molecular formula C9H12F2N2 and a molecular weight of 186.20 g/mol. Its IUPAC name is 2,5-difluoro-2,7,7-trimethyl-1,4-diazocine.
| Compound Name | 2,5-difluoro-2,7,7-trimethyl-1,4-diazocine |
|---|---|
| PubChem CID | 148589459 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2,5-difluoro-2,7,7-trimethyl-1,4-diazocine |
| SMILES | CC1(C)C=NC(C)(F)C=NC(F)=C1 |
| InChI | InChI=1S/C9H12F2N2/c1-8(2)4-7(10)12-6-9(3,11)13-5-8/h4-6H,1-3H3 |
| InChIKey | NAIQNRBYCUMUCE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|