About (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone
(3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone (PubChem CID 1485901) has the molecular formula C11H8Cl2N2OS
and a molecular weight of 287.17 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone |
| PubChem CID | 1485901 |
| Molecular Formula | C11H8Cl2N2OS |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone |
| SMILES | CNc1ncc(C(=O)c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C11H8Cl2N2OS/c1-14-11-15-5-9(17-11)10(16)6-2-3-7(12)8(13)4-6/h2-5H,1H3,(H,14,15) |
| InChIKey | XJMMGQRRJYYUJB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone?
The IUPAC name of (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone (CID 1485901) is (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone.
What is the SMILES notation for (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone?
The canonical SMILES for (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone is CNc1ncc(C(=O)c2ccc(Cl)c(Cl)c2)s1.
What is the InChIKey of (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone?
The InChIKey is XJMMGQRRJYYUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2N2OS/c1-14-11-15-5-9(17-11)10(16)6-2-3-7(12)8(13)4-6/h2-5H,1H3,(H,14,15).
What are the key properties of (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone?
(3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone has a molecular weight of 287.17 g/mol, XLogP of 3.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl)-[2-(methylamino)-1,3-thiazol-5-yl]methanone is sourced from PubChem (CID 1485901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).