About [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone
[2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone (PubChem CID 1485902) has the molecular formula C11H10N2OS
and a molecular weight of 218.28 g/mol. Its IUPAC name is [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone |
| PubChem CID | 1485902 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone |
| SMILES | CNc1ncc(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C11H10N2OS/c1-12-11-13-7-9(15-11)10(14)8-5-3-2-4-6-8/h2-7H,1H3,(H,12,13) |
| InChIKey | ACIORWSBZIKYKH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone?
The IUPAC name of [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone (CID 1485902) is [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone.
What is the SMILES notation for [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone?
The canonical SMILES for [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone is CNc1ncc(C(=O)c2ccccc2)s1.
What is the InChIKey of [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone?
The InChIKey is ACIORWSBZIKYKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2OS/c1-12-11-13-7-9(15-11)10(14)8-5-3-2-4-6-8/h2-7H,1H3,(H,12,13).
What are the key properties of [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone?
[2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone has a molecular weight of 218.28 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)-1,3-thiazol-5-yl]-phenylmethanone is sourced from PubChem (CID 1485902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).