C28H30ClFN2O — CID 148590962
1-(5-chloro-15-ethenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(4-fluorophenyl)hept-6-en-2-ol (PubChem CID 148590962) has the molecular formula C28H30ClFN2O and a molecular weight of 465.01 g/mol. Its IUPAC name is 1-(5-chloro-15-ethenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(4-fluorophenyl)hept-6-en-2-ol.
| Compound Name | 1-(5-chloro-15-ethenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(4-fluorophenyl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 148590962 |
| Molecular Formula | C28H30ClFN2O |
| Molecular Weight | 465.01 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-(5-chloro-15-ethenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(4-fluorophenyl)hept-6-en-2-ol |
| SMILES | C=CCCCC(O)(Cn1c2c(c3cc(Cl)ccc31)C1CCC(C2)N1C=C)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H30ClFN2O/c1-3-5-6-15-28(33,19-7-10-21(30)11-8-19)18-32-24-13-9-20(29)16-23(24)27-25-14-12-22(17-26(27)32)31(25)4-2/h3-4,7-11,13,16,22,25,33H,1-2,5-6,12,14-15,17-18H2 |
| InChIKey | NAQAKORXKHMKHV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.01 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|