About [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone
[2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone (PubChem CID 1485936) has the molecular formula C16H10Cl2N2OS
and a molecular weight of 349.24 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone |
| PubChem CID | 1485936 |
| Molecular Formula | C16H10Cl2N2OS |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cnc(Nc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C16H10Cl2N2OS/c17-12-7-6-11(8-13(12)18)20-16-19-9-14(22-16)15(21)10-4-2-1-3-5-10/h1-9H,(H,19,20) |
| InChIKey | NJFOBLXUYRGYLS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone?
The IUPAC name of [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone (CID 1485936) is [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone.
What is the SMILES notation for [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone?
The canonical SMILES for [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone is O=C(c1ccccc1)c1cnc(Nc2ccc(Cl)c(Cl)c2)s1.
What is the InChIKey of [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone?
The InChIKey is NJFOBLXUYRGYLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2N2OS/c17-12-7-6-11(8-13(12)18)20-16-19-9-14(22-16)15(21)10-4-2-1-3-5-10/h1-9H,(H,19,20).
What are the key properties of [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone?
[2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone has a molecular weight of 349.24 g/mol, XLogP of 5.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dichloroanilino)-1,3-thiazol-5-yl]-phenylmethanone is sourced from PubChem (CID 1485936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).