About 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone
1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone (PubChem CID 1485939) has the molecular formula C13H14O5S2
and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone |
| PubChem CID | 1485939 |
| Molecular Formula | C13H14O5S2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone |
| SMILES | CC(=O)C1=C(S(=O)(=O)c2ccc(C)cc2)CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14O5S2/c1-9-3-5-11(6-4-9)20(17,18)13-8-19(15,16)7-12(13)10(2)14/h3-6H,7-8H2,1-2H3 |
| InChIKey | MJIXXDBVPOZQDI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone?
The IUPAC name of 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone (CID 1485939) is 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone.
What is the SMILES notation for 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone?
The canonical SMILES for 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone is CC(=O)C1=C(S(=O)(=O)c2ccc(C)cc2)CS(=O)(=O)C1.
What is the InChIKey of 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone?
The InChIKey is MJIXXDBVPOZQDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5S2/c1-9-3-5-11(6-4-9)20(17,18)13-8-19(15,16)7-12(13)10(2)14/h3-6H,7-8H2,1-2H3.
What are the key properties of 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone?
1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone has a molecular weight of 314.38 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,5-dihydrothiophen-3-yl]ethanone is sourced from PubChem (CID 1485939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).