About 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine
1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine (PubChem CID 148596054) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine.
Molecular Properties
| Compound Name | 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine |
| PubChem CID | 148596054 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine |
| SMILES | [H]/N=C1\C(=C(C)N)CNC1(C)C |
| InChI | InChI=1S/C8H15N3/c1-5(9)6-4-11-8(2,3)7(6)10/h10-11H,4,9H2,1-3H3/b6-5?,10-7+ |
| InChIKey | QONPEVMLXTWDLR-JDVLXEGBSA-N |
| XLogP | 0.62 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine?
The IUPAC name of 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine (CID 148596054) is 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine.
What is the SMILES notation for 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine?
The canonical SMILES for 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine is [H]/N=C1\C(=C(C)N)CNC1(C)C.
What is the InChIKey of 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine?
The InChIKey is QONPEVMLXTWDLR-JDVLXEGBSA-N. The full InChI is InChI=1S/C8H15N3/c1-5(9)6-4-11-8(2,3)7(6)10/h10-11H,4,9H2,1-3H3/b6-5?,10-7+.
What are the key properties of 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine?
1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine has a molecular weight of 153.23 g/mol, XLogP of 0.62, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-imino-5,5-dimethylpyrrolidin-3-ylidene)ethanamine is sourced from PubChem (CID 148596054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).