About 6-bromopyran-2-one
6-bromopyran-2-one (PubChem CID 14859626) has the molecular formula C5H3BrO2
and a molecular weight of 174.98 g/mol. Its IUPAC name is 6-bromopyran-2-one.
Molecular Properties
| Compound Name | 6-bromopyran-2-one |
| PubChem CID | 14859626 |
| Molecular Formula | C5H3BrO2 |
| Molecular Weight | 174.98 g/mol |
| Exact Mass | 173.93 |
| IUPAC Name | 6-bromopyran-2-one |
| SMILES | O=c1cccc(Br)o1 |
| InChI | InChI=1S/C5H3BrO2/c6-4-2-1-3-5(7)8-4/h1-3H |
| InChIKey | DCGQCHWUJXHDKB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.98 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromopyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromopyran-2-one?
The IUPAC name of 6-bromopyran-2-one (CID 14859626) is 6-bromopyran-2-one.
What is the SMILES notation for 6-bromopyran-2-one?
The canonical SMILES for 6-bromopyran-2-one is O=c1cccc(Br)o1.
What is the InChIKey of 6-bromopyran-2-one?
The InChIKey is DCGQCHWUJXHDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrO2/c6-4-2-1-3-5(7)8-4/h1-3H.
What are the key properties of 6-bromopyran-2-one?
6-bromopyran-2-one has a molecular weight of 174.98 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromopyran-2-one is sourced from PubChem (CID 14859626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).