C5H7FO3 — CID 14859657
(3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-one (PubChem CID 14859657) has the molecular formula C5H7FO3 and a molecular weight of 134.11 g/mol. Its IUPAC name is (3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-one.
| Compound Name | (3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 14859657 |
| Molecular Formula | C5H7FO3 |
| Molecular Weight | 134.11 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | (3S,5S)-3-fluoro-5-(hydroxymethyl)oxolan-2-one |
| SMILES | O=C1O[C@H](CO)C[C@@H]1F |
| InChI | InChI=1S/C5H7FO3/c6-4-1-3(2-7)9-5(4)8/h3-4,7H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | QQOBGZZHJMIFCC-IMJSIDKUSA-N |
| XLogP | -0.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.11 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |