C8H14O7 — CID 14859670
[(2S,3R,4S,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 14859670) has the molecular formula C8H14O7 and a molecular weight of 222.19 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 14859670 |
| Molecular Formula | C8H14O7 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C8H14O7/c1-3(10)14-7-6(12)5(11)4(2-9)15-8(7)13/h4-9,11-13H,2H2,1H3/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | ANUMJPWPBOXOQE-CBQIKETKSA-N |
| XLogP | -2.65 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |