About 2-(disulfanyl)adamantane
2-(disulfanyl)adamantane (PubChem CID 148597481) has the molecular formula C10H16S2
and a molecular weight of 200.37 g/mol. Its IUPAC name is 2-(disulfanyl)adamantane.
Molecular Properties
| Compound Name | 2-(disulfanyl)adamantane |
| PubChem CID | 148597481 |
| Molecular Formula | C10H16S2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-(disulfanyl)adamantane |
| SMILES | SSC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C10H16S2/c11-12-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-11H,1-5H2 |
| InChIKey | NBVVGWQTMFZCOL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(disulfanyl)adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(disulfanyl)adamantane?
The IUPAC name of 2-(disulfanyl)adamantane (CID 148597481) is 2-(disulfanyl)adamantane.
What is the SMILES notation for 2-(disulfanyl)adamantane?
The canonical SMILES for 2-(disulfanyl)adamantane is SSC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-(disulfanyl)adamantane?
The InChIKey is NBVVGWQTMFZCOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S2/c11-12-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-11H,1-5H2.
What are the key properties of 2-(disulfanyl)adamantane?
2-(disulfanyl)adamantane has a molecular weight of 200.37 g/mol, XLogP of 3.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(disulfanyl)adamantane is sourced from PubChem (CID 148597481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).