C26H20F2NO+ — CID 148597744
2-(1,7-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium (PubChem CID 148597744) has the molecular formula C26H20F2NO+ and a molecular weight of 400.45 g/mol. Its IUPAC name is 2-(1,7-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-(1,7-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 148597744 |
| Molecular Formula | C26H20F2NO+ |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-(1,7-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium |
| SMILES | Cc1ccc(-c2c(C)cc(F)c3c2oc2c(-c4ccccc4)c(F)ccc23)[n+](C)c1 |
| InChI | InChI=1S/C26H20F2NO/c1-15-9-12-21(29(3)14-15)22-16(2)13-20(28)24-18-10-11-19(27)23(25(18)30-26(22)24)17-7-5-4-6-8-17/h4-14H,1-3H3/q+1 |
| InChIKey | GUPKSUKDRGYHQN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|