C19H15F4N5O2 — CID 148598139
2-[5-[(4S,6S)-2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-6-fluoro-3-pyridinyl]-1-(5-isocyano-2-pyridinyl)ethanone (PubChem CID 148598139) has the molecular formula C19H15F4N5O2 and a molecular weight of 421.35 g/mol. Its IUPAC name is 2-[5-[(4S,6S)-2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-6-fluoro-3-pyridinyl]-1-(5-isocyano-2-pyridinyl)ethanone.
| Compound Name | 2-[5-[(4S,6S)-2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-6-fluoro-3-pyridinyl]-1-(5-isocyano-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 148598139 |
| Molecular Formula | C19H15F4N5O2 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-[5-[(4S,6S)-2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-6-fluoro-3-pyridinyl]-1-(5-isocyano-2-pyridinyl)ethanone |
| SMILES | [C-]#[N+]c1ccc(C(=O)Cc2cnc(F)c([C@]3(C)C[C@@H](C(F)(F)F)OC(N)=N3)c2)nc1 |
| InChI | InChI=1S/C19H15F4N5O2/c1-18(7-15(19(21,22)23)30-17(24)28-18)12-5-10(8-27-16(12)20)6-14(29)13-4-3-11(25-2)9-26-13/h3-5,8-9,15H,6-7H2,1H3,(H2,24,28)/t15-,18-/m0/s1 |
| InChIKey | NBZCLHYNQHKACL-YJBOKZPZSA-N |
| XLogP | 3.47 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|