C30H41NO15 — CID 14860180
[(2R,3S,4S,5R,6S)-6-[(2R,3S,4R,5R,6R)-5-acetamido-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 14860180) has the molecular formula C30H41NO15 and a molecular weight of 655.65 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[(2R,3S,4R,5R,6R)-5-acetamido-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[(2R,3S,4R,5R,6R)-5-acetamido-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14860180 |
| Molecular Formula | C30H41NO15 |
| Molecular Weight | 655.65 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(2R,3S,4R,5R,6R)-5-acetamido-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OCc2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C30H41NO15/c1-15(33)31-23-26(40-13-20-10-8-7-9-11-20)24(21(12-32)44-29(23)38-6)46-30-28(43-19(5)37)27(42-18(4)36)25(41-17(3)35)22(45-30)14-39-16(2)34/h7-11,21-30,32H,12-14H2,1-6H3,(H,31,33)/t21-,22-,23-,24-,25+,26-,27+,28-,29-,30+/m1/s1 |
| InChIKey | SINFGXZPFNCPAB-XRAAFVHPSA-N |
| XLogP | -0.09 |
| TPSA | 200.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.65 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|