C9H12N2O5S — CID 148602319
3-(cyclopropylmethoxy)-1-sulfamoylpyrrole-2-carboxylic acid (PubChem CID 148602319) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-1-sulfamoylpyrrole-2-carboxylic acid.
| Compound Name | 3-(cyclopropylmethoxy)-1-sulfamoylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 148602319 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-(cyclopropylmethoxy)-1-sulfamoylpyrrole-2-carboxylic acid |
| SMILES | NS(=O)(=O)n1ccc(OCC2CC2)c1C(=O)O |
| InChI | InChI=1S/C9H12N2O5S/c10-17(14,15)11-4-3-7(8(11)9(12)13)16-5-6-1-2-6/h3-4,6H,1-2,5H2,(H,12,13)(H2,10,14,15) |
| InChIKey | NCSZOHQWPIVUHH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |