C12H16F3NO2S — CID 148603549
N-[(1,5-dimethylcycloocta-2,4,7-trien-1-yl)methyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 148603549) has the molecular formula C12H16F3NO2S and a molecular weight of 295.33 g/mol. Its IUPAC name is N-[(1,5-dimethylcycloocta-2,4,7-trien-1-yl)methyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(1,5-dimethylcycloocta-2,4,7-trien-1-yl)methyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 148603549 |
| Molecular Formula | C12H16F3NO2S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[(1,5-dimethylcycloocta-2,4,7-trien-1-yl)methyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC1=CC=CC(C)(CNS(=O)(=O)C(F)(F)F)C=CC1 |
| InChI | InChI=1S/C12H16F3NO2S/c1-10-5-3-7-11(2,8-4-6-10)9-16-19(17,18)12(13,14)15/h3-5,7-8,16H,6,9H2,1-2H3 |
| InChIKey | NCYUHVLZTAEJES-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|