About (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine
(3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine (PubChem CID 148603751) has the molecular formula C6H8FN
and a molecular weight of 113.14 g/mol. Its IUPAC name is (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine.
Molecular Properties
| Compound Name | (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine |
| PubChem CID | 148603751 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.14 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine |
| SMILES | C=C1N=CCC[C@@H]1F |
| InChI | InChI=1S/C6H8FN/c1-5-6(7)3-2-4-8-5/h4,6H,1-3H2/t6-/m0/s1 |
| InChIKey | NCZUKKLMQVQEKC-LURJTMIESA-N |
| XLogP | 1.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.14 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine?
The IUPAC name of (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine (CID 148603751) is (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine.
What is the SMILES notation for (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine?
The canonical SMILES for (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine is C=C1N=CCC[C@@H]1F.
What is the InChIKey of (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine?
The InChIKey is NCZUKKLMQVQEKC-LURJTMIESA-N. The full InChI is InChI=1S/C6H8FN/c1-5-6(7)3-2-4-8-5/h4,6H,1-3H2/t6-/m0/s1.
What are the key properties of (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine?
(3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine has a molecular weight of 113.14 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-fluoro-2-methylidene-4,5-dihydro-3H-pyridine is sourced from PubChem (CID 148603751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).