C24H30O5 — CID 14860514
2-[[(1S,2R,3aS,9aS)-1-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid (PubChem CID 14860514) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[[(1S,2R,3aS,9aS)-1-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid.
| Compound Name | 2-[[(1S,2R,3aS,9aS)-1-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 14860514 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[[(1S,2R,3aS,9aS)-1-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1C[C@H]1C[C@@H](O)[C@H](C#C[C@@H](O)C3CCCCC3)[C@H]1C2 |
| InChI | InChI=1S/C24H30O5/c25-21(15-5-2-1-3-6-15)10-9-18-19-11-16-7-4-8-23(29-14-24(27)28)20(16)12-17(19)13-22(18)26/h4,7-8,15,17-19,21-22,25-26H,1-3,5-6,11-14H2,(H,27,28)/t17-,18+,19-,21+,22+/m0/s1 |
| InChIKey | KHDCACCYYAXEOD-PLJZGSKRSA-N |
| XLogP | 2.81 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|