C27H26F2N3O+ — CID 148605918
8-[7-(2,2-dimethylpropyl)-3-methylquinazolin-3-ium-4-yl]-2,4-difluoro-6,7-dimethyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 148605918) has the molecular formula C27H26F2N3O+ and a molecular weight of 446.52 g/mol. Its IUPAC name is 8-[7-(2,2-dimethylpropyl)-3-methylquinazolin-3-ium-4-yl]-2,4-difluoro-6,7-dimethyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[7-(2,2-dimethylpropyl)-3-methylquinazolin-3-ium-4-yl]-2,4-difluoro-6,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 148605918 |
| Molecular Formula | C27H26F2N3O+ |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 8-[7-(2,2-dimethylpropyl)-3-methylquinazolin-3-ium-4-yl]-2,4-difluoro-6,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1cc2c(oc3nc(F)cc(F)c32)c(-c2c3ccc(CC(C)(C)C)cc3nc[n+]2C)c1C |
| InChI | InChI=1S/C27H26F2N3O/c1-14-9-18-23-19(28)11-21(29)31-26(23)33-25(18)22(15(14)2)24-17-8-7-16(12-27(3,4)5)10-20(17)30-13-32(24)6/h7-11,13H,12H2,1-6H3/q+1 |
| InChIKey | VIMHVCCOSKIUAX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|