C21H30O3 — CID 14860775
[(8R,9S,10S,13S,14S)-13-methyl-17-oxo-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate (PubChem CID 14860775) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S)-13-methyl-17-oxo-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate.
| Compound Name | [(8R,9S,10S,13S,14S)-13-methyl-17-oxo-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate |
|---|---|
| PubChem CID | 14860775 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(8R,9S,10S,13S,14S)-13-methyl-17-oxo-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-10-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CCCC=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H30O3/c1-14(22)24-13-21-11-4-3-5-15(21)6-7-16-17-8-9-19(23)20(17,2)12-10-18(16)21/h5,16-18H,3-4,6-13H2,1-2H3/t16-,17-,18-,20-,21+/m0/s1 |
| InChIKey | QLZOSNWYWZNEJT-OAGDOXAWSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|