C14H19F3N2S — CID 148608736
1-methyl-5-[4-(4,4,4-trifluorobutylsulfanyl)-2H-pyrrol-5-yl]-3,6-dihydro-2H-pyridine (PubChem CID 148608736) has the molecular formula C14H19F3N2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 1-methyl-5-[4-(4,4,4-trifluorobutylsulfanyl)-2H-pyrrol-5-yl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-methyl-5-[4-(4,4,4-trifluorobutylsulfanyl)-2H-pyrrol-5-yl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 148608736 |
| Molecular Formula | C14H19F3N2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-methyl-5-[4-(4,4,4-trifluorobutylsulfanyl)-2H-pyrrol-5-yl]-3,6-dihydro-2H-pyridine |
| SMILES | CN1CCC=C(C2=NCC=C2SCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H19F3N2S/c1-19-8-2-4-11(10-19)13-12(5-7-18-13)20-9-3-6-14(15,16)17/h4-5H,2-3,6-10H2,1H3 |
| InChIKey | NDYFFSXNJHBWDI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|