C18H22ClN5O2S — CID 148614261
2-(6-chloro-1,5-naphthyridin-3-yl)-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylimino]prop-1-en-1-amine (PubChem CID 148614261) has the molecular formula C18H22ClN5O2S and a molecular weight of 407.93 g/mol. Its IUPAC name is 2-(6-chloro-1,5-naphthyridin-3-yl)-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylimino]prop-1-en-1-amine.
| Compound Name | 2-(6-chloro-1,5-naphthyridin-3-yl)-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylimino]prop-1-en-1-amine |
|---|---|
| PubChem CID | 148614261 |
| Molecular Formula | C18H22ClN5O2S |
| Molecular Weight | 407.93 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-(6-chloro-1,5-naphthyridin-3-yl)-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylimino]prop-1-en-1-amine |
| SMILES | NC=C(/C=N/CCCN1CCS(=O)(=O)CC1)c1cnc2ccc(Cl)nc2c1 |
| InChI | InChI=1S/C18H22ClN5O2S/c19-18-3-2-16-17(23-18)10-14(13-22-16)15(11-20)12-21-4-1-5-24-6-8-27(25,26)9-7-24/h2-3,10-13H,1,4-9,20H2/b15-11?,21-12+ |
| InChIKey | MFMJXBNJFXDFQO-XKUWLGOASA-N |
| XLogP | 1.77 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.93 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|